About 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine
3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine (PubChem CID 178092720) has the molecular formula C11H14IN5
and a molecular weight of 343.17 g/mol. Its IUPAC name is 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine |
| PubChem CID | 178092720 |
| Molecular Formula | C11H14IN5 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine |
| SMILES | Cc1nc(C2CCN(I)C2)n2ccnc(N)c12 |
| InChI | InChI=1S/C11H14IN5/c1-7-9-10(13)14-3-5-17(9)11(15-7)8-2-4-16(12)6-8/h3,5,8H,2,4,6H2,1H3,(H2,13,14) |
| InChIKey | LYGSTVYRNZLYTK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine?
The IUPAC name of 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine (CID 178092720) is 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine.
What is the SMILES notation for 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine?
The canonical SMILES for 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine is Cc1nc(C2CCN(I)C2)n2ccnc(N)c12.
What is the InChIKey of 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine?
The InChIKey is LYGSTVYRNZLYTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14IN5/c1-7-9-10(13)14-3-5-17(9)11(15-7)8-2-4-16(12)6-8/h3,5,8H,2,4,6H2,1H3,(H2,13,14).
What are the key properties of 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine?
3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine has a molecular weight of 343.17 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine is sourced from PubChem (CID 178092720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).