C11H14IN5 — CID 178092720
3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine (PubChem CID 178092720) has the molecular formula C11H14IN5 and a molecular weight of 343.17 g/mol. Its IUPAC name is 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 178092720 |
| Molecular Formula | C11H14IN5 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 3-(1-iodopyrrolidin-3-yl)-1-methylimidazo[1,5-a]pyrazin-8-amine |
| SMILES | Cc1nc(C2CCN(I)C2)n2ccnc(N)c12 |
| InChI | InChI=1S/C11H14IN5/c1-7-9-10(13)14-3-5-17(9)11(15-7)8-2-4-16(12)6-8/h3,5,8H,2,4,6H2,1H3,(H2,13,14) |
| InChIKey | LYGSTVYRNZLYTK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|