C11H13N3 — CID 83829000
3-cyclopropyl-1-methylimidazo[1,5-a]pyridin-8-amine (PubChem CID 83829000) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 3-cyclopropyl-1-methylimidazo[1,5-a]pyridin-8-amine.
| Compound Name | 3-cyclopropyl-1-methylimidazo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 83829000 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 3-cyclopropyl-1-methylimidazo[1,5-a]pyridin-8-amine |
| SMILES | Cc1nc(C2CC2)n2cccc(N)c12 |
| InChI | InChI=1S/C11H13N3/c1-7-10-9(12)3-2-6-14(10)11(13-7)8-4-5-8/h2-3,6,8H,4-5,12H2,1H3 |
| InChIKey | XSGUUPCZDZAAEV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |