C12H14N4 — CID 83886369
3-cyclopropyl-1-methylimidazo[1,5-a]pyridine-8-carboximidamide (PubChem CID 83886369) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-cyclopropyl-1-methylimidazo[1,5-a]pyridine-8-carboximidamide.
| Compound Name | 3-cyclopropyl-1-methylimidazo[1,5-a]pyridine-8-carboximidamide |
|---|---|
| PubChem CID | 83886369 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 3-cyclopropyl-1-methylimidazo[1,5-a]pyridine-8-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccn2c(C3CC3)nc(C)c12 |
| InChI | InChI=1S/C12H14N4/c1-7-10-9(11(13)14)3-2-6-16(10)12(15-7)8-4-5-8/h2-3,6,8H,4-5H2,1H3,(H3,13,14) |
| InChIKey | UTDQTZDQKLYLQU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|