C15H17N5S — CID 28601951
2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide (PubChem CID 28601951) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide.
| Compound Name | 2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 28601951 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1Sc1nnc(C2CC2)n1C1CC1 |
| InChI | InChI=1S/C15H17N5S/c16-13(17)11-3-1-2-4-12(11)21-15-19-18-14(9-5-6-9)20(15)10-7-8-10/h1-4,9-10H,5-8H2,(H3,16,17) |
| InChIKey | NPMAZAUEJSIWMB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|