C14H14Cl2N4S — CID 130364508
2,6-dichloro-3-[(5-cyclobutyl-4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]pyridine (PubChem CID 130364508) has the molecular formula C14H14Cl2N4S and a molecular weight of 341.27 g/mol. Its IUPAC name is 2,6-dichloro-3-[(5-cyclobutyl-4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]pyridine.
| Compound Name | 2,6-dichloro-3-[(5-cyclobutyl-4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]pyridine |
|---|---|
| PubChem CID | 130364508 |
| Molecular Formula | C14H14Cl2N4S |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 2,6-dichloro-3-[(5-cyclobutyl-4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]pyridine |
| SMILES | Clc1ccc(Sc2nnc(C3CCC3)n2C2CC2)c(Cl)n1 |
| InChI | InChI=1S/C14H14Cl2N4S/c15-11-7-6-10(12(16)17-11)21-14-19-18-13(8-2-1-3-8)20(14)9-4-5-9/h6-9H,1-5H2 |
| InChIKey | YEIQEJUXZULSRQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|