C11H12N4 — CID 83880717
3-cyclopropylimidazo[1,5-a]pyridine-5-carboximidamide (PubChem CID 83880717) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is 3-cyclopropylimidazo[1,5-a]pyridine-5-carboximidamide.
| Compound Name | 3-cyclopropylimidazo[1,5-a]pyridine-5-carboximidamide |
|---|---|
| PubChem CID | 83880717 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 3-cyclopropylimidazo[1,5-a]pyridine-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccc2cnc(C3CC3)n12 |
| InChI | InChI=1S/C11H12N4/c12-10(13)9-3-1-2-8-6-14-11(15(8)9)7-4-5-7/h1-3,6-7H,4-5H2,(H3,12,13) |
| InChIKey | WOBLHMNKZGEVHW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|