C12H13ClN2O2S — CID 117141476
3-(5-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide (PubChem CID 117141476) has the molecular formula C12H13ClN2O2S and a molecular weight of 284.77 g/mol. Its IUPAC name is 3-(5-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide.
| Compound Name | 3-(5-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117141476 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 3-(5-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC(c2ncc3cccc(Cl)n23)C1 |
| InChI | InChI=1S/C12H13ClN2O2S/c13-11-5-1-4-10-7-14-12(15(10)11)9-3-2-6-18(16,17)8-9/h1,4-5,7,9H,2-3,6,8H2 |
| InChIKey | VRASKCXXQFZFRY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|