C13H14N2O4S — CID 117142556
3-(1,1-dioxothian-3-yl)imidazo[1,5-a]pyridine-5-carboxylic acid (PubChem CID 117142556) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-(1,1-dioxothian-3-yl)imidazo[1,5-a]pyridine-5-carboxylic acid.
| Compound Name | 3-(1,1-dioxothian-3-yl)imidazo[1,5-a]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 117142556 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-(1,1-dioxothian-3-yl)imidazo[1,5-a]pyridine-5-carboxylic acid |
| SMILES | O=C(O)c1cccc2cnc(C3CCCS(=O)(=O)C3)n12 |
| InChI | InChI=1S/C13H14N2O4S/c16-13(17)11-5-1-4-10-7-14-12(15(10)11)9-3-2-6-20(18,19)8-9/h1,4-5,7,9H,2-3,6,8H2,(H,16,17) |
| InChIKey | YKXBAPHALFAVRF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |