C13H16IN5 — CID 175693251
1-iodo-3-[(3S)-1-prop-2-enylpyrrolidin-3-yl]imidazo[1,5-a]pyrazin-8-amine (PubChem CID 175693251) has the molecular formula C13H16IN5 and a molecular weight of 369.21 g/mol. Its IUPAC name is 1-iodo-3-[(3S)-1-prop-2-enylpyrrolidin-3-yl]imidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 1-iodo-3-[(3S)-1-prop-2-enylpyrrolidin-3-yl]imidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 175693251 |
| Molecular Formula | C13H16IN5 |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 1-iodo-3-[(3S)-1-prop-2-enylpyrrolidin-3-yl]imidazo[1,5-a]pyrazin-8-amine |
| SMILES | C=CCN1CC[C@H](c2nc(I)c3c(N)nccn23)C1 |
| InChI | InChI=1S/C13H16IN5/c1-2-5-18-6-3-9(8-18)13-17-11(14)10-12(15)16-4-7-19(10)13/h2,4,7,9H,1,3,5-6,8H2,(H2,15,16)/t9-/m0/s1 |
| InChIKey | QSOZLUPMLBZVTI-VIFPVBQESA-N |
| XLogP | 1.89 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|