C19H20IN5O2 — CID 42609369
benzyl 4-(8-amino-1-iodoimidazo[1,5-a]pyrazin-3-yl)piperidine-1-carboxylate (PubChem CID 42609369) has the molecular formula C19H20IN5O2 and a molecular weight of 477.31 g/mol. Its IUPAC name is benzyl 4-(8-amino-1-iodoimidazo[1,5-a]pyrazin-3-yl)piperidine-1-carboxylate.
| Compound Name | benzyl 4-(8-amino-1-iodoimidazo[1,5-a]pyrazin-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 42609369 |
| Molecular Formula | C19H20IN5O2 |
| Molecular Weight | 477.31 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | benzyl 4-(8-amino-1-iodoimidazo[1,5-a]pyrazin-3-yl)piperidine-1-carboxylate |
| SMILES | Nc1nccn2c(C3CCN(C(=O)OCc4ccccc4)CC3)nc(I)c12 |
| InChI | InChI=1S/C19H20IN5O2/c20-16-15-17(21)22-8-11-25(15)18(23-16)14-6-9-24(10-7-14)19(26)27-12-13-4-2-1-3-5-13/h1-5,8,11,14H,6-7,9-10,12H2,(H2,21,22) |
| InChIKey | PSEAUZJBUSDMHI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|