C19H17IN6OS — CID 66738508
[4-(8-amino-1-iodoimidazo[1,5-a]pyrazin-3-yl)piperidin-1-yl]-(1,3-benzothiazol-6-yl)methanone (PubChem CID 66738508) has the molecular formula C19H17IN6OS and a molecular weight of 504.36 g/mol. Its IUPAC name is [4-(8-amino-1-iodoimidazo[1,5-a]pyrazin-3-yl)piperidin-1-yl]-(1,3-benzothiazol-6-yl)methanone.
| Compound Name | [4-(8-amino-1-iodoimidazo[1,5-a]pyrazin-3-yl)piperidin-1-yl]-(1,3-benzothiazol-6-yl)methanone |
|---|---|
| PubChem CID | 66738508 |
| Molecular Formula | C19H17IN6OS |
| Molecular Weight | 504.36 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | [4-(8-amino-1-iodoimidazo[1,5-a]pyrazin-3-yl)piperidin-1-yl]-(1,3-benzothiazol-6-yl)methanone |
| SMILES | Nc1nccn2c(C3CCN(C(=O)c4ccc5ncsc5c4)CC3)nc(I)c12 |
| InChI | InChI=1S/C19H17IN6OS/c20-16-15-17(21)22-5-8-26(15)18(24-16)11-3-6-25(7-4-11)19(27)12-1-2-13-14(9-12)28-10-23-13/h1-2,5,8-11H,3-4,6-7H2,(H2,21,22) |
| InChIKey | LIDRZEPUKKXJBU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|