C18H22FNO4 — CID 169091117
6-fluoro-2-methoxy-3-[2-(3,4,5-trimethoxyphenyl)ethyl]aniline (PubChem CID 169091117) has the molecular formula C18H22FNO4 and a molecular weight of 335.38 g/mol. Its IUPAC name is 6-fluoro-2-methoxy-3-[2-(3,4,5-trimethoxyphenyl)ethyl]aniline.
| Compound Name | 6-fluoro-2-methoxy-3-[2-(3,4,5-trimethoxyphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 169091117 |
| Molecular Formula | C18H22FNO4 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 6-fluoro-2-methoxy-3-[2-(3,4,5-trimethoxyphenyl)ethyl]aniline |
| SMILES | COc1cc(CCc2ccc(F)c(N)c2OC)cc(OC)c1OC |
| InChI | InChI=1S/C18H22FNO4/c1-21-14-9-11(10-15(22-2)18(14)24-4)5-6-12-7-8-13(19)16(20)17(12)23-3/h7-10H,5-6,20H2,1-4H3 |
| InChIKey | QMMSELYJSZVLNU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|