C21H17FIN5 — CID 169093085
6-(4-fluorophenyl)-8-iodo-N-[(1R)-1-(6-methylpyridazin-3-yl)ethyl]quinazolin-4-amine (PubChem CID 169093085) has the molecular formula C21H17FIN5 and a molecular weight of 485.30 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-8-iodo-N-[(1R)-1-(6-methylpyridazin-3-yl)ethyl]quinazolin-4-amine.
| Compound Name | 6-(4-fluorophenyl)-8-iodo-N-[(1R)-1-(6-methylpyridazin-3-yl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 169093085 |
| Molecular Formula | C21H17FIN5 |
| Molecular Weight | 485.30 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | 6-(4-fluorophenyl)-8-iodo-N-[(1R)-1-(6-methylpyridazin-3-yl)ethyl]quinazolin-4-amine |
| SMILES | Cc1ccc([C@@H](C)Nc2ncnc3c(I)cc(-c4ccc(F)cc4)cc23)nn1 |
| InChI | InChI=1S/C21H17FIN5/c1-12-3-8-19(28-27-12)13(2)26-21-17-9-15(14-4-6-16(22)7-5-14)10-18(23)20(17)24-11-25-21/h3-11,13H,1-2H3,(H,24,25,26)/t13-/m1/s1 |
| InChIKey | SQTZIEQYQMBXDC-CYBMUJFWSA-N |
| XLogP | 5.31 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.30 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|