C20H24O8Si4 — CID 169094034
2,4,6,8-tetrakis(furan-2-yl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 169094034) has the molecular formula C20H24O8Si4 and a molecular weight of 504.75 g/mol. Its IUPAC name is 2,4,6,8-tetrakis(furan-2-yl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetrakis(furan-2-yl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 169094034 |
| Molecular Formula | C20H24O8Si4 |
| Molecular Weight | 504.75 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | 2,4,6,8-tetrakis(furan-2-yl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[Si]1(c2ccco2)O[Si](C)(c2ccco2)O[Si](C)(c2ccco2)O[Si](C)(c2ccco2)O1 |
| InChI | InChI=1S/C20H24O8Si4/c1-29(17-9-5-13-21-17)25-30(2,18-10-6-14-22-18)27-32(4,20-12-8-16-24-20)28-31(3,26-29)19-11-7-15-23-19/h5-16H,1-4H3 |
| InChIKey | PQYXQGZNBIWYSB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.75 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|