C23H26N4O4S — CID 169094598
3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-(cyclopropylmethyl)-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate (PubChem CID 169094598) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-(cyclopropylmethyl)-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate.
| Compound Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-(cyclopropylmethyl)-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate |
|---|---|
| PubChem CID | 169094598 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-(cyclopropylmethyl)-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate |
| SMILES | O=c1c(CN2CCN(S(=O)(=O)c3ccccc3)CC2)c([O-])[n+](CC2CC2)c2ccccn12 |
| InChI | InChI=1S/C23H26N4O4S/c28-22-20(23(29)27(16-18-9-10-18)21-8-4-5-11-26(21)22)17-24-12-14-25(15-13-24)32(30,31)19-6-2-1-3-7-19/h1-8,11,18H,9-10,12-17H2 |
| InChIKey | PGRFAXYVHNPMHA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|