C32H42N4O2 — CID 169094668
N-[[1-[4-[1-(oxan-2-yl)pyrazol-4-yl]phenyl]piperidin-4-yl]methyl]-6-phenylhexanamide (PubChem CID 169094668) has the molecular formula C32H42N4O2 and a molecular weight of 514.71 g/mol. Its IUPAC name is N-[[1-[4-[1-(oxan-2-yl)pyrazol-4-yl]phenyl]piperidin-4-yl]methyl]-6-phenylhexanamide.
| Compound Name | N-[[1-[4-[1-(oxan-2-yl)pyrazol-4-yl]phenyl]piperidin-4-yl]methyl]-6-phenylhexanamide |
|---|---|
| PubChem CID | 169094668 |
| Molecular Formula | C32H42N4O2 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | N-[[1-[4-[1-(oxan-2-yl)pyrazol-4-yl]phenyl]piperidin-4-yl]methyl]-6-phenylhexanamide |
| SMILES | O=C(CCCCCc1ccccc1)NCC1CCN(c2ccc(-c3cnn(C4CCCCO4)c3)cc2)CC1 |
| InChI | InChI=1S/C32H42N4O2/c37-31(12-6-2-5-11-26-9-3-1-4-10-26)33-23-27-18-20-35(21-19-27)30-16-14-28(15-17-30)29-24-34-36(25-29)32-13-7-8-22-38-32/h1,3-4,9-10,14-17,24-25,27,32H,2,5-8,11-13,18-23H2,(H,33,37) |
| InChIKey | XHBTWTLZLDTTCU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|