C14H11F2N4O3S- — CID 169099455
6-fluoro-1-[2-fluoro-4-[(sulfinatoamino)methyl]phenyl]-5-methoxybenzotriazole (PubChem CID 169099455) has the molecular formula C14H11F2N4O3S- and a molecular weight of 353.33 g/mol. Its IUPAC name is 6-fluoro-1-[2-fluoro-4-[(sulfinatoamino)methyl]phenyl]-5-methoxybenzotriazole.
| Compound Name | 6-fluoro-1-[2-fluoro-4-[(sulfinatoamino)methyl]phenyl]-5-methoxybenzotriazole |
|---|---|
| PubChem CID | 169099455 |
| Molecular Formula | C14H11F2N4O3S- |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 6-fluoro-1-[2-fluoro-4-[(sulfinatoamino)methyl]phenyl]-5-methoxybenzotriazole |
| SMILES | COc1cc2nnn(-c3ccc(CNS(=O)[O-])cc3F)c2cc1F |
| InChI | InChI=1S/C14H12F2N4O3S/c1-23-14-6-11-13(5-10(14)16)20(19-18-11)12-3-2-8(4-9(12)15)7-17-24(21)22/h2-6,17H,7H2,1H3,(H,21,22)/p-1 |
| InChIKey | PXZYLWFUGXSLBL-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|