C15H15N4O4S- — CID 169099435
5,6-dimethoxy-1-[4-[(sulfinatoamino)methyl]phenyl]benzotriazole (PubChem CID 169099435) has the molecular formula C15H15N4O4S- and a molecular weight of 347.38 g/mol. Its IUPAC name is 5,6-dimethoxy-1-[4-[(sulfinatoamino)methyl]phenyl]benzotriazole.
| Compound Name | 5,6-dimethoxy-1-[4-[(sulfinatoamino)methyl]phenyl]benzotriazole |
|---|---|
| PubChem CID | 169099435 |
| Molecular Formula | C15H15N4O4S- |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 5,6-dimethoxy-1-[4-[(sulfinatoamino)methyl]phenyl]benzotriazole |
| SMILES | COc1cc2nnn(-c3ccc(CNS(=O)[O-])cc3)c2cc1OC |
| InChI | InChI=1S/C15H16N4O4S/c1-22-14-7-12-13(8-15(14)23-2)19(18-17-12)11-5-3-10(4-6-11)9-16-24(20)21/h3-8,16H,9H2,1-2H3,(H,20,21)/p-1 |
| InChIKey | NJNIRQUGZSHNQT-UHFFFAOYSA-M |
| XLogP | 1.32 |
| TPSA | 101.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|