C15H14N4O5S — CID 174155352
[4-(6-methoxybenzotriazol-1-yl)phenyl]methylsulfonylcarbamic acid (PubChem CID 174155352) has the molecular formula C15H14N4O5S and a molecular weight of 362.37 g/mol. Its IUPAC name is [4-(6-methoxybenzotriazol-1-yl)phenyl]methylsulfonylcarbamic acid.
| Compound Name | [4-(6-methoxybenzotriazol-1-yl)phenyl]methylsulfonylcarbamic acid |
|---|---|
| PubChem CID | 174155352 |
| Molecular Formula | C15H14N4O5S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | [4-(6-methoxybenzotriazol-1-yl)phenyl]methylsulfonylcarbamic acid |
| SMILES | COc1ccc2nnn(-c3ccc(CS(=O)(=O)NC(=O)O)cc3)c2c1 |
| InChI | InChI=1S/C15H14N4O5S/c1-24-12-6-7-13-14(8-12)19(18-16-13)11-4-2-10(3-5-11)9-25(22,23)17-15(20)21/h2-8,17H,9H2,1H3,(H,20,21) |
| InChIKey | KHQKBNZDOMLZMA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |