C14H13N5O5S — CID 175462596
[3-(5-methoxybenzotriazol-1-yl)phenyl]sulfamoyl carbamate (PubChem CID 175462596) has the molecular formula C14H13N5O5S and a molecular weight of 363.36 g/mol. Its IUPAC name is [3-(5-methoxybenzotriazol-1-yl)phenyl]sulfamoyl carbamate.
| Compound Name | [3-(5-methoxybenzotriazol-1-yl)phenyl]sulfamoyl carbamate |
|---|---|
| PubChem CID | 175462596 |
| Molecular Formula | C14H13N5O5S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | [3-(5-methoxybenzotriazol-1-yl)phenyl]sulfamoyl carbamate |
| SMILES | COc1ccc2c(c1)nnn2-c1cccc(NS(=O)(=O)OC(N)=O)c1 |
| InChI | InChI=1S/C14H13N5O5S/c1-23-11-5-6-13-12(8-11)16-18-19(13)10-4-2-3-9(7-10)17-25(21,22)24-14(15)20/h2-8,17H,1H3,(H2,15,20) |
| InChIKey | IIZCANRFHDWXFV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |