C24H23N5O2 — CID 51587763
N-[(R)-(3-methoxyphenyl)-phenylmethyl]-2-[4-(5-methyltetrazol-1-yl)phenyl]acetamide (PubChem CID 51587763) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[(R)-(3-methoxyphenyl)-phenylmethyl]-2-[4-(5-methyltetrazol-1-yl)phenyl]acetamide.
| Compound Name | N-[(R)-(3-methoxyphenyl)-phenylmethyl]-2-[4-(5-methyltetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 51587763 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[(R)-(3-methoxyphenyl)-phenylmethyl]-2-[4-(5-methyltetrazol-1-yl)phenyl]acetamide |
| SMILES | COc1cccc([C@H](NC(=O)Cc2ccc(-n3nnnc3C)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H23N5O2/c1-17-26-27-28-29(17)21-13-11-18(12-14-21)15-23(30)25-24(19-7-4-3-5-8-19)20-9-6-10-22(16-20)31-2/h3-14,16,24H,15H2,1-2H3,(H,25,30)/t24-/m1/s1 |
| InChIKey | KICYKQZGTSTBPA-XMMPIXPASA-N |
| XLogP | 3.43 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |