C21H24N4O2 — CID 51591501
N-[(S)-(3-methoxyphenyl)-phenylmethyl]-2-(4-propan-2-yltriazol-1-yl)acetamide (PubChem CID 51591501) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[(S)-(3-methoxyphenyl)-phenylmethyl]-2-(4-propan-2-yltriazol-1-yl)acetamide.
| Compound Name | N-[(S)-(3-methoxyphenyl)-phenylmethyl]-2-(4-propan-2-yltriazol-1-yl)acetamide |
|---|---|
| PubChem CID | 51591501 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | N-[(S)-(3-methoxyphenyl)-phenylmethyl]-2-(4-propan-2-yltriazol-1-yl)acetamide |
| SMILES | COc1cccc([C@@H](NC(=O)Cn2cc(C(C)C)nn2)c2ccccc2)c1 |
| InChI | InChI=1S/C21H24N4O2/c1-15(2)19-13-25(24-23-19)14-20(26)22-21(16-8-5-4-6-9-16)17-10-7-11-18(12-17)27-3/h4-13,15,21H,14H2,1-3H3,(H,22,26)/t21-/m0/s1 |
| InChIKey | YESFIXGXGXKOKF-NRFANRHFSA-N |
| XLogP | 3.32 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |