C18H18FN5O2 — CID 74241272
N-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-[4-(5-methyltetrazol-1-yl)phenyl]acetamide (PubChem CID 74241272) has the molecular formula C18H18FN5O2 and a molecular weight of 355.37 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-[4-(5-methyltetrazol-1-yl)phenyl]acetamide.
| Compound Name | N-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-[4-(5-methyltetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 74241272 |
| Molecular Formula | C18H18FN5O2 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-[4-(5-methyltetrazol-1-yl)phenyl]acetamide |
| SMILES | Cc1nnnn1-c1ccc(CC(=O)NCC(O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C18H18FN5O2/c1-12-21-22-23-24(12)14-8-6-13(7-9-14)10-18(26)20-11-17(25)15-4-2-3-5-16(15)19/h2-9,17,25H,10-11H2,1H3,(H,20,26) |
| InChIKey | AFEDLWLIFBBYEL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |