C11H16N4O — CID 169099964
11,12-dimethyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 169099964) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 11,12-dimethyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | 11,12-dimethyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 169099964 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 11,12-dimethyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | CC1Cc2nn3c(c2CN1C)C(=O)NCC3 |
| InChI | InChI=1S/C11H16N4O/c1-7-5-9-8(6-14(7)2)10-11(16)12-3-4-15(10)13-9/h7H,3-6H2,1-2H3,(H,12,16) |
| InChIKey | OKEKVRBKPRODQE-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |