C28H26ClF5N6O4S — CID 169100164
7-chloro-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-[(2S)-2-methyl-4-(2,3,4,5-tetrafluoro-6-methoxyphenyl)sulfonylpiperazin-1-yl]pyrido[2,3-d]pyrimidin-2-one (PubChem CID 169100164) has the molecular formula C28H26ClF5N6O4S and a molecular weight of 673.06 g/mol. Its IUPAC name is 7-chloro-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-[(2S)-2-methyl-4-(2,3,4,5-tetrafluoro-6-methoxyphenyl)sulfonylpiperazin-1-yl]pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 7-chloro-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-[(2S)-2-methyl-4-(2,3,4,5-tetrafluoro-6-methoxyphenyl)sulfonylpiperazin-1-yl]pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 169100164 |
| Molecular Formula | C28H26ClF5N6O4S |
| Molecular Weight | 673.06 g/mol |
| Exact Mass | 672.13 |
| IUPAC Name | 7-chloro-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-[(2S)-2-methyl-4-(2,3,4,5-tetrafluoro-6-methoxyphenyl)sulfonylpiperazin-1-yl]pyrido[2,3-d]pyrimidin-2-one |
| SMILES | COc1c(F)c(F)c(F)c(F)c1S(=O)(=O)N1CCN(c2nc(=O)n(-c3c(C)ccnc3C(C)C)c3nc(Cl)c(F)cc23)[C@@H](C)C1 |
| InChI | InChI=1S/C28H26ClF5N6O4S/c1-12(2)21-22(13(3)6-7-35-21)40-27-15(10-16(30)25(29)36-27)26(37-28(40)41)39-9-8-38(11-14(39)4)45(42,43)24-20(34)18(32)17(31)19(33)23(24)44-5/h6-7,10,12,14H,8-9,11H2,1-5H3/t14-/m0/s1 |
| InChIKey | MPZBFMBLLYIHFG-AWEZNQCLSA-N |
| XLogP | 4.86 |
| TPSA | 110.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.06 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|