C17H19N2OP — CID 169100395
2-[2-[phenyl(propan-2-yl)phosphoryl]ethyl]pyridine-4-carbonitrile (PubChem CID 169100395) has the molecular formula C17H19N2OP and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-[2-[phenyl(propan-2-yl)phosphoryl]ethyl]pyridine-4-carbonitrile.
| Compound Name | 2-[2-[phenyl(propan-2-yl)phosphoryl]ethyl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 169100395 |
| Molecular Formula | C17H19N2OP |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-[2-[phenyl(propan-2-yl)phosphoryl]ethyl]pyridine-4-carbonitrile |
| SMILES | CC(C)[P@@](=O)(CCc1cc(C#N)ccn1)c1ccccc1 |
| InChI | InChI=1S/C17H19N2OP/c1-14(2)21(20,17-6-4-3-5-7-17)11-9-16-12-15(13-18)8-10-19-16/h3-8,10,12,14H,9,11H2,1-2H3/t21-/m0/s1 |
| InChIKey | VSKSAACJJYDVNA-NRFANRHFSA-N |
| XLogP | 3.59 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|