About 2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile
2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile (PubChem CID 139407498) has the molecular formula C12H11N3O
and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile |
| PubChem CID | 139407498 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile |
| SMILES | Cc1cc(CCc2cc(C#N)ccn2)no1 |
| InChI | InChI=1S/C12H11N3O/c1-9-6-12(15-16-9)3-2-11-7-10(8-13)4-5-14-11/h4-7H,2-3H2,1H3 |
| InChIKey | YGHLKUVOWYILNC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile?
The IUPAC name of 2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile (CID 139407498) is 2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile.
What is the SMILES notation for 2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile?
The canonical SMILES for 2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile is Cc1cc(CCc2cc(C#N)ccn2)no1.
What is the InChIKey of 2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile?
The InChIKey is YGHLKUVOWYILNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O/c1-9-6-12(15-16-9)3-2-11-7-10(8-13)4-5-14-11/h4-7H,2-3H2,1H3.
What are the key properties of 2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile?
2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile has a molecular weight of 213.24 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(5-methyl-1,2-oxazol-3-yl)ethyl]pyridine-4-carbonitrile is sourced from PubChem (CID 139407498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).