C22H27NO — CID 169104069
(2Z)-N,2-dimethyl-3,4-diphenyl-1-propoxypenta-2,4-dien-1-amine (PubChem CID 169104069) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is (2Z)-N,2-dimethyl-3,4-diphenyl-1-propoxypenta-2,4-dien-1-amine.
| Compound Name | (2Z)-N,2-dimethyl-3,4-diphenyl-1-propoxypenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 169104069 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (2Z)-N,2-dimethyl-3,4-diphenyl-1-propoxypenta-2,4-dien-1-amine |
| SMILES | C=C(/C(=C(/C)C(NC)OCCC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO/c1-5-16-24-22(23-4)18(3)21(20-14-10-7-11-15-20)17(2)19-12-8-6-9-13-19/h6-15,22-23H,2,5,16H2,1,3-4H3/b21-18+ |
| InChIKey | MBPNDMYEIMUPEL-DYTRJAOYSA-N |
| XLogP | 5.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|