C29H39F2N2O3 — CID 169108961
CID 169108961 (PubChem CID 169108961) has the molecular formula C29H39F2N2O3 and a molecular weight of 501.64 g/mol.
| Compound Name | CID 169108961 |
|---|---|
| PubChem CID | 169108961 |
| Molecular Formula | C29H39F2N2O3 |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)[C@@H](Cc1cccc(N2CCC(F)(F)C2)c1)[C@H]1CCN(C(=O)C2=C[C]2C(C)(C)C)C1 |
| InChI | InChI=1S/C29H39F2N2O3/c1-27(2,3)24-16-23(24)25(34)32-12-10-20(17-32)22(26(35)36-28(4,5)6)15-19-8-7-9-21(14-19)33-13-11-29(30,31)18-33/h7-9,14,16,20,22H,10-13,15,17-18H2,1-6H3/t20-,22-/m0/s1 |
| InChIKey | IOMCJFHZWIYHLP-UNMCSNQZSA-N |
| XLogP | 5.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |