C32H45N3O6 — CID 175587375
tert-butyl (3R)-3-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-[3-[2-(phenylmethoxycarbonylamino)ethylamino]phenyl]propan-2-yl]pyrrolidine-1-carboxylate (PubChem CID 175587375) has the molecular formula C32H45N3O6 and a molecular weight of 567.73 g/mol. Its IUPAC name is tert-butyl (3R)-3-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-[3-[2-(phenylmethoxycarbonylamino)ethylamino]phenyl]propan-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-[3-[2-(phenylmethoxycarbonylamino)ethylamino]phenyl]propan-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175587375 |
| Molecular Formula | C32H45N3O6 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.33 |
| IUPAC Name | tert-butyl (3R)-3-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-[3-[2-(phenylmethoxycarbonylamino)ethylamino]phenyl]propan-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C(Cc1cccc(NCCNC(=O)OCc2ccccc2)c1)[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C32H45N3O6/c1-31(2,3)40-28(36)27(25-15-18-35(21-25)30(38)41-32(4,5)6)20-24-13-10-14-26(19-24)33-16-17-34-29(37)39-22-23-11-8-7-9-12-23/h7-14,19,25,27,33H,15-18,20-22H2,1-6H3,(H,34,37)/t25-,27?/m0/s1 |
| InChIKey | KEMVVGLFGSGVOB-PVCWFJFTSA-N |
| XLogP | 5.78 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|