C18H24FN3O4 — CID 169110724
tert-butyl (1R,6S)-5-(2-fluoro-6-methoxycarbonyl-3-pyridinyl)-2,5-diazabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 169110724) has the molecular formula C18H24FN3O4 and a molecular weight of 365.41 g/mol. Its IUPAC name is tert-butyl (1R,6S)-5-(2-fluoro-6-methoxycarbonyl-3-pyridinyl)-2,5-diazabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | tert-butyl (1R,6S)-5-(2-fluoro-6-methoxycarbonyl-3-pyridinyl)-2,5-diazabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 169110724 |
| Molecular Formula | C18H24FN3O4 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | tert-butyl (1R,6S)-5-(2-fluoro-6-methoxycarbonyl-3-pyridinyl)-2,5-diazabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)[C@@H]3CC[C@@H]32)c(F)n1 |
| InChI | InChI=1S/C18H24FN3O4/c1-18(2,3)26-17(24)22-10-9-21(12-7-8-13(12)22)14-6-5-11(16(23)25-4)20-15(14)19/h5-6,12-13H,7-10H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | HHYFUOHEPQTAQB-QWHCGFSZSA-N |
| XLogP | 2.60 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|