C12H16F3N3O2 — CID 169111965
acetamide;N-methyl-N-[1-[5-(trifluoromethyl)-2-pyridinyl]ethyl]formamide (PubChem CID 169111965) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is acetamide;N-methyl-N-[1-[5-(trifluoromethyl)-2-pyridinyl]ethyl]formamide.
| Compound Name | acetamide;N-methyl-N-[1-[5-(trifluoromethyl)-2-pyridinyl]ethyl]formamide |
|---|---|
| PubChem CID | 169111965 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | acetamide;N-methyl-N-[1-[5-(trifluoromethyl)-2-pyridinyl]ethyl]formamide |
| SMILES | CC(N)=O.CC(c1ccc(C(F)(F)F)cn1)N(C)C=O |
| InChI | InChI=1S/C10H11F3N2O.C2H5NO/c1-7(15(2)6-16)9-4-3-8(5-14-9)10(11,12)13;1-2(3)4/h3-7H,1-2H3;1H3,(H2,3,4) |
| InChIKey | BSFZJOPILPSYLL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|