C19H25N3S — CID 169112319
2-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]-5-[(3S)-3-methyl-2,3,4,5-tetrahydropyridin-6-yl]-1,3-benzothiazole (PubChem CID 169112319) has the molecular formula C19H25N3S and a molecular weight of 327.50 g/mol. Its IUPAC name is 2-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]-5-[(3S)-3-methyl-2,3,4,5-tetrahydropyridin-6-yl]-1,3-benzothiazole.
| Compound Name | 2-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]-5-[(3S)-3-methyl-2,3,4,5-tetrahydropyridin-6-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 169112319 |
| Molecular Formula | C19H25N3S |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]-5-[(3S)-3-methyl-2,3,4,5-tetrahydropyridin-6-yl]-1,3-benzothiazole |
| SMILES | C[C@H]1CCC(c2ccc3sc([C@@H]4CN(C)C[C@H]4C)nc3c2)=NC1 |
| InChI | InChI=1S/C19H25N3S/c1-12-4-6-16(20-9-12)14-5-7-18-17(8-14)21-19(23-18)15-11-22(3)10-13(15)2/h5,7-8,12-13,15H,4,6,9-11H2,1-3H3/t12-,13+,15+/m0/s1 |
| InChIKey | MGJNZNLAVNNHNQ-GZBFAFLISA-N |
| XLogP | 4.18 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |