C23H33N3S — CID 175470901
5-(3-methyl-2,3,4,5-tetrahydropyridin-6-yl)-2-(1,2,2,3,3-pentamethylpiperidin-4-yl)-1,3-benzothiazole (PubChem CID 175470901) has the molecular formula C23H33N3S and a molecular weight of 383.61 g/mol. Its IUPAC name is 5-(3-methyl-2,3,4,5-tetrahydropyridin-6-yl)-2-(1,2,2,3,3-pentamethylpiperidin-4-yl)-1,3-benzothiazole.
| Compound Name | 5-(3-methyl-2,3,4,5-tetrahydropyridin-6-yl)-2-(1,2,2,3,3-pentamethylpiperidin-4-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 175470901 |
| Molecular Formula | C23H33N3S |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 5-(3-methyl-2,3,4,5-tetrahydropyridin-6-yl)-2-(1,2,2,3,3-pentamethylpiperidin-4-yl)-1,3-benzothiazole |
| SMILES | CC1CCC(c2ccc3sc(C4CCN(C)C(C)(C)C4(C)C)nc3c2)=NC1 |
| InChI | InChI=1S/C23H33N3S/c1-15-7-9-18(24-14-15)16-8-10-20-19(13-16)25-21(27-20)17-11-12-26(6)23(4,5)22(17,2)3/h8,10,13,15,17H,7,9,11-12,14H2,1-6H3 |
| InChIKey | AGVJUWHUQZOFPB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |