C21H32N4 — CID 169112387
6-[(2R,5S)-5-methylpiperidin-2-yl]-2-(1,5,5-trimethylpiperidin-3-yl)indazole (PubChem CID 169112387) has the molecular formula C21H32N4 and a molecular weight of 340.52 g/mol. Its IUPAC name is 6-[(2R,5S)-5-methylpiperidin-2-yl]-2-(1,5,5-trimethylpiperidin-3-yl)indazole.
| Compound Name | 6-[(2R,5S)-5-methylpiperidin-2-yl]-2-(1,5,5-trimethylpiperidin-3-yl)indazole |
|---|---|
| PubChem CID | 169112387 |
| Molecular Formula | C21H32N4 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 6-[(2R,5S)-5-methylpiperidin-2-yl]-2-(1,5,5-trimethylpiperidin-3-yl)indazole |
| SMILES | C[C@H]1CC[C@H](c2ccc3cn(C4CN(C)CC(C)(C)C4)nc3c2)NC1 |
| InChI | InChI=1S/C21H32N4/c1-15-5-8-19(22-11-15)16-6-7-17-12-25(23-20(17)9-16)18-10-21(2,3)14-24(4)13-18/h6-7,9,12,15,18-19,22H,5,8,10-11,13-14H2,1-4H3/t15-,18?,19+/m0/s1 |
| InChIKey | XLTLMPVWVPXPQA-JMRRQPBMSA-N |
| XLogP | 4.00 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |