C31H41N5OS — CID 169112832
2-amino-3-methylquinoline-6-carbaldehyde;1,3-dimethylpiperidine;2-(1-methylpiperidin-4-yl)-1,3-benzothiazole (PubChem CID 169112832) has the molecular formula C31H41N5OS and a molecular weight of 531.77 g/mol. Its IUPAC name is 2-amino-3-methylquinoline-6-carbaldehyde;1,3-dimethylpiperidine;2-(1-methylpiperidin-4-yl)-1,3-benzothiazole.
| Compound Name | 2-amino-3-methylquinoline-6-carbaldehyde;1,3-dimethylpiperidine;2-(1-methylpiperidin-4-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 169112832 |
| Molecular Formula | C31H41N5OS |
| Molecular Weight | 531.77 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | 2-amino-3-methylquinoline-6-carbaldehyde;1,3-dimethylpiperidine;2-(1-methylpiperidin-4-yl)-1,3-benzothiazole |
| SMILES | CC1CCCN(C)C1.CN1CCC(c2nc3ccccc3s2)CC1.Cc1cc2cc(C=O)ccc2nc1N |
| InChI | InChI=1S/C13H16N2S.C11H10N2O.C7H15N/c1-15-8-6-10(7-9-15)13-14-11-4-2-3-5-12(11)16-13;1-7-4-9-5-8(6-14)2-3-10(9)13-11(7)12;1-7-4-3-5-8(2)6-7/h2-5,10H,6-9H2,1H3;2-6H,1H3,(H2,12,13);7H,3-6H2,1-2H3 |
| InChIKey | ITICMPAGMCEHQQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.77 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|