C20H27N3OS — CID 169112369
(2R)-5-methyl-2-[2-(1-methylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidine-1-carbaldehyde (PubChem CID 169112369) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is (2R)-5-methyl-2-[2-(1-methylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidine-1-carbaldehyde.
| Compound Name | (2R)-5-methyl-2-[2-(1-methylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 169112369 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (2R)-5-methyl-2-[2-(1-methylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidine-1-carbaldehyde |
| SMILES | CC1CC[C@H](c2ccc3sc(C4CCN(C)CC4)nc3c2)N(C=O)C1 |
| InChI | InChI=1S/C20H27N3OS/c1-14-3-5-18(23(12-14)13-24)16-4-6-19-17(11-16)21-20(25-19)15-7-9-22(2)10-8-15/h4,6,11,13-15,18H,3,5,7-10,12H2,1-2H3/t14?,18-/m1/s1 |
| InChIKey | TZTTYBPFLQRBMD-XPKAQORNSA-N |
| XLogP | 4.03 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|