C21H28N4O2S — CID 169113507
2-[(2R,5S)-5-methyl-2-[2-[(3R)-1-methylpiperidin-3-yl]-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxoacetamide (PubChem CID 169113507) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is 2-[(2R,5S)-5-methyl-2-[2-[(3R)-1-methylpiperidin-3-yl]-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxoacetamide.
| Compound Name | 2-[(2R,5S)-5-methyl-2-[2-[(3R)-1-methylpiperidin-3-yl]-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 169113507 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[(2R,5S)-5-methyl-2-[2-[(3R)-1-methylpiperidin-3-yl]-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxoacetamide |
| SMILES | C[C@H]1CC[C@H](c2ccc3sc([C@@H]4CCCN(C)C4)nc3c2)N(C(=O)C(N)=O)C1 |
| InChI | InChI=1S/C21H28N4O2S/c1-13-5-7-17(25(11-13)21(27)19(22)26)14-6-8-18-16(10-14)23-20(28-18)15-4-3-9-24(2)12-15/h6,8,10,13,15,17H,3-5,7,9,11-12H2,1-2H3,(H2,22,26)/t13-,15+,17+/m0/s1 |
| InChIKey | PEKWDMKUZDBWGH-YSVLISHTSA-N |
| XLogP | 2.89 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|