C33H45N7O3SSi — CID 169113775
2-[(2R,5S)-5-methyl-2-[2-(1-methylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxo-N-[3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-6-yl]acetamide (PubChem CID 169113775) has the molecular formula C33H45N7O3SSi and a molecular weight of 647.92 g/mol. Its IUPAC name is 2-[(2R,5S)-5-methyl-2-[2-(1-methylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxo-N-[3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-6-yl]acetamide.
| Compound Name | 2-[(2R,5S)-5-methyl-2-[2-(1-methylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxo-N-[3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-6-yl]acetamide |
|---|---|
| PubChem CID | 169113775 |
| Molecular Formula | C33H45N7O3SSi |
| Molecular Weight | 647.92 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | 2-[(2R,5S)-5-methyl-2-[2-(1-methylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxo-N-[3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-6-yl]acetamide |
| SMILES | C[C@H]1CC[C@H](c2ccc3sc(C4CCN(C)CC4)nc3c2)N(C(=O)C(=O)Nc2cnc3c(c2)ncn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C33H45N7O3SSi/c1-22-6-8-28(24-7-9-29-26(16-24)37-32(44-29)23-10-12-38(2)13-11-23)40(19-22)33(42)31(41)36-25-17-27-30(34-18-25)39(20-35-27)21-43-14-15-45(3,4)5/h7,9,16-18,20,22-23,28H,6,8,10-15,19,21H2,1-5H3,(H,36,41)/t22-,28+/m0/s1 |
| InChIKey | JHVYXGGPAKPLCV-RBISFHTESA-N |
| XLogP | 6.10 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.92 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|