C6H2Br3NO — CID 169113247
2,4,5-tribromopyridine-3-carbaldehyde (PubChem CID 169113247) has the molecular formula C6H2Br3NO and a molecular weight of 343.80 g/mol. Its IUPAC name is 2,4,5-tribromopyridine-3-carbaldehyde.
| Compound Name | 2,4,5-tribromopyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 169113247 |
| Molecular Formula | C6H2Br3NO |
| Molecular Weight | 343.80 g/mol |
| Exact Mass | 340.77 |
| IUPAC Name | 2,4,5-tribromopyridine-3-carbaldehyde |
| SMILES | O=Cc1c(Br)ncc(Br)c1Br |
| InChI | InChI=1S/C6H2Br3NO/c7-4-1-10-6(9)3(2-11)5(4)8/h1-2H |
| InChIKey | JTGFWIHKTJNWIR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|