C16H31NO3 — CID 169113993
tert-butyl N-(4-ethoxy-3-methylbut-1-en-2-yl)-N-(2-methylpropyl)carbamate (PubChem CID 169113993) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is tert-butyl N-(4-ethoxy-3-methylbut-1-en-2-yl)-N-(2-methylpropyl)carbamate.
| Compound Name | tert-butyl N-(4-ethoxy-3-methylbut-1-en-2-yl)-N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 169113993 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | tert-butyl N-(4-ethoxy-3-methylbut-1-en-2-yl)-N-(2-methylpropyl)carbamate |
| SMILES | C=C(C(C)COCC)N(CC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31NO3/c1-9-19-11-13(4)14(5)17(10-12(2)3)15(18)20-16(6,7)8/h12-13H,5,9-11H2,1-4,6-8H3 |
| InChIKey | GJHJEBIRRYMVNJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |