C12H21F2N — CID 169114303
(2R,5S)-2-(4,4-difluorocyclohexyl)-5-methylpiperidine (PubChem CID 169114303) has the molecular formula C12H21F2N and a molecular weight of 217.30 g/mol. Its IUPAC name is (2R,5S)-2-(4,4-difluorocyclohexyl)-5-methylpiperidine.
| Compound Name | (2R,5S)-2-(4,4-difluorocyclohexyl)-5-methylpiperidine |
|---|---|
| PubChem CID | 169114303 |
| Molecular Formula | C12H21F2N |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (2R,5S)-2-(4,4-difluorocyclohexyl)-5-methylpiperidine |
| SMILES | C[C@H]1CC[C@H](C2CCC(F)(F)CC2)NC1 |
| InChI | InChI=1S/C12H21F2N/c1-9-2-3-11(15-8-9)10-4-6-12(13,14)7-5-10/h9-11,15H,2-8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | GQIGOZAQCUKYSN-GXSJLCMTSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |