C23H24F4N2O2 — CID 169116173
acetylene;5-amino-1-[7-[3-fluoro-4-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-isoquinolin-2-yl]pentan-1-one (PubChem CID 169116173) has the molecular formula C23H24F4N2O2 and a molecular weight of 436.45 g/mol. Its IUPAC name is acetylene;5-amino-1-[7-[3-fluoro-4-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-isoquinolin-2-yl]pentan-1-one.
| Compound Name | acetylene;5-amino-1-[7-[3-fluoro-4-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-isoquinolin-2-yl]pentan-1-one |
|---|---|
| PubChem CID | 169116173 |
| Molecular Formula | C23H24F4N2O2 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | acetylene;5-amino-1-[7-[3-fluoro-4-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-isoquinolin-2-yl]pentan-1-one |
| SMILES | C#C.NCCCCC(=O)N1CCc2ccc(Oc3ccc(C(F)(F)F)c(F)c3)cc2C1 |
| InChI | InChI=1S/C21H22F4N2O2.C2H2/c22-19-12-17(6-7-18(19)21(23,24)25)29-16-5-4-14-8-10-27(13-15(14)11-16)20(28)3-1-2-9-26;1-2/h4-7,11-12H,1-3,8-10,13,26H2;1-2H |
| InChIKey | MQRTYYQTPTZQCQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|