C17H19F4N5O2 — CID 169117680
5-fluoro-2-[[(3S,4R)-3-hydroxyoxan-4-yl]amino]-7-(1,1,1-trifluoro-3-methylbutan-2-yl)pyrrolo[2,1-f][1,2,4]triazine-6-carbonitrile (PubChem CID 169117680) has the molecular formula C17H19F4N5O2 and a molecular weight of 401.36 g/mol. Its IUPAC name is 5-fluoro-2-[[(3S,4R)-3-hydroxyoxan-4-yl]amino]-7-(1,1,1-trifluoro-3-methylbutan-2-yl)pyrrolo[2,1-f][1,2,4]triazine-6-carbonitrile.
| Compound Name | 5-fluoro-2-[[(3S,4R)-3-hydroxyoxan-4-yl]amino]-7-(1,1,1-trifluoro-3-methylbutan-2-yl)pyrrolo[2,1-f][1,2,4]triazine-6-carbonitrile |
|---|---|
| PubChem CID | 169117680 |
| Molecular Formula | C17H19F4N5O2 |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 5-fluoro-2-[[(3S,4R)-3-hydroxyoxan-4-yl]amino]-7-(1,1,1-trifluoro-3-methylbutan-2-yl)pyrrolo[2,1-f][1,2,4]triazine-6-carbonitrile |
| SMILES | CC(C)C(c1c(C#N)c(F)c2cnc(N[C@@H]3CCOC[C@H]3O)nn12)C(F)(F)F |
| InChI | InChI=1S/C17H19F4N5O2/c1-8(2)13(17(19,20)21)15-9(5-22)14(18)11-6-23-16(25-26(11)15)24-10-3-4-28-7-12(10)27/h6,8,10,12-13,27H,3-4,7H2,1-2H3,(H,24,25)/t10-,12-,13?/m1/s1 |
| InChIKey | NMAJYKONPDKYPP-HLVWMGJTSA-N |
| XLogP | 2.60 |
| TPSA | 95.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |