C18H24F3N5O2 — CID 170062376
(3S,4R)-4-[[7-[1-(2,2-difluoroethyl)piperidin-4-yl]-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol (PubChem CID 170062376) has the molecular formula C18H24F3N5O2 and a molecular weight of 399.42 g/mol. Its IUPAC name is (3S,4R)-4-[[7-[1-(2,2-difluoroethyl)piperidin-4-yl]-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol.
| Compound Name | (3S,4R)-4-[[7-[1-(2,2-difluoroethyl)piperidin-4-yl]-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol |
|---|---|
| PubChem CID | 170062376 |
| Molecular Formula | C18H24F3N5O2 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (3S,4R)-4-[[7-[1-(2,2-difluoroethyl)piperidin-4-yl]-5-fluoropyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-ol |
| SMILES | O[C@@H]1COCC[C@H]1Nc1ncc2c(F)cc(C3CCN(CC(F)F)CC3)n2n1 |
| InChI | InChI=1S/C18H24F3N5O2/c19-12-7-14(11-1-4-25(5-2-11)9-17(20)21)26-15(12)8-22-18(24-26)23-13-3-6-28-10-16(13)27/h7-8,11,13,16-17,27H,1-6,9-10H2,(H,23,24)/t13-,16-/m1/s1 |
| InChIKey | CRGARHNXSJOOCR-CZUORRHYSA-N |
| XLogP | 1.87 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |