C16H16F4N4O3 — CID 169117674
[(3S,4R)-4-[[5-fluoro-7-(3,3,3-trifluoroprop-1-en-2-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-yl] acetate (PubChem CID 169117674) has the molecular formula C16H16F4N4O3 and a molecular weight of 388.32 g/mol. Its IUPAC name is [(3S,4R)-4-[[5-fluoro-7-(3,3,3-trifluoroprop-1-en-2-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-yl] acetate.
| Compound Name | [(3S,4R)-4-[[5-fluoro-7-(3,3,3-trifluoroprop-1-en-2-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 169117674 |
| Molecular Formula | C16H16F4N4O3 |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [(3S,4R)-4-[[5-fluoro-7-(3,3,3-trifluoroprop-1-en-2-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]oxan-3-yl] acetate |
| SMILES | C=C(c1cc(F)c2cnc(N[C@@H]3CCOC[C@H]3OC(C)=O)nn12)C(F)(F)F |
| InChI | InChI=1S/C16H16F4N4O3/c1-8(16(18,19)20)12-5-10(17)13-6-21-15(23-24(12)13)22-11-3-4-26-7-14(11)27-9(2)25/h5-6,11,14H,1,3-4,7H2,2H3,(H,22,23)/t11-,14-/m1/s1 |
| InChIKey | SJQTYHZKNZRGMN-BXUZGUMPSA-N |
| XLogP | 2.58 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |