C14H14BrF2N3O2 — CID 170740164
(3S,4R)-4-[[8-bromo-6-(difluoromethyl)quinazolin-2-yl]amino]oxan-3-ol (PubChem CID 170740164) has the molecular formula C14H14BrF2N3O2 and a molecular weight of 374.19 g/mol. Its IUPAC name is (3S,4R)-4-[[8-bromo-6-(difluoromethyl)quinazolin-2-yl]amino]oxan-3-ol.
| Compound Name | (3S,4R)-4-[[8-bromo-6-(difluoromethyl)quinazolin-2-yl]amino]oxan-3-ol |
|---|---|
| PubChem CID | 170740164 |
| Molecular Formula | C14H14BrF2N3O2 |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | (3S,4R)-4-[[8-bromo-6-(difluoromethyl)quinazolin-2-yl]amino]oxan-3-ol |
| SMILES | O[C@@H]1COCC[C@H]1Nc1ncc2cc(C(F)F)cc(Br)c2n1 |
| InChI | InChI=1S/C14H14BrF2N3O2/c15-9-4-7(13(16)17)3-8-5-18-14(20-12(8)9)19-10-1-2-22-6-11(10)21/h3-5,10-11,13,21H,1-2,6H2,(H,18,19,20)/t10-,11-/m1/s1 |
| InChIKey | OBWZGMFVQGHGMF-GHMZBOCLSA-N |
| XLogP | 2.89 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |