C15H17BrF2N4O3S — CID 174173294
2-[[8-bromo-6-(difluoromethyl)quinazolin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol (PubChem CID 174173294) has the molecular formula C15H17BrF2N4O3S and a molecular weight of 451.29 g/mol. Its IUPAC name is 2-[[8-bromo-6-(difluoromethyl)quinazolin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol.
| Compound Name | 2-[[8-bromo-6-(difluoromethyl)quinazolin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 174173294 |
| Molecular Formula | C15H17BrF2N4O3S |
| Molecular Weight | 451.29 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 2-[[8-bromo-6-(difluoromethyl)quinazolin-2-yl]amino]-1-methylsulfonylpiperidin-3-ol |
| SMILES | CS(=O)(=O)N1CCCC(O)C1Nc1ncc2cc(C(F)F)cc(Br)c2n1 |
| InChI | InChI=1S/C15H17BrF2N4O3S/c1-26(24,25)22-4-2-3-11(23)14(22)21-15-19-7-9-5-8(13(17)18)6-10(16)12(9)20-15/h5-7,11,13-14,23H,2-4H2,1H3,(H,19,20,21) |
| InChIKey | ZCHGZJGYOJIPSZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |