C17H27BrN4O4S — CID 167089967
2-[5-bromo-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-4-yl]oxycycloheptan-1-ol (PubChem CID 167089967) has the molecular formula C17H27BrN4O4S and a molecular weight of 463.40 g/mol. Its IUPAC name is 2-[5-bromo-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-4-yl]oxycycloheptan-1-ol.
| Compound Name | 2-[5-bromo-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-4-yl]oxycycloheptan-1-ol |
|---|---|
| PubChem CID | 167089967 |
| Molecular Formula | C17H27BrN4O4S |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2-[5-bromo-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-4-yl]oxycycloheptan-1-ol |
| SMILES | CS(=O)(=O)N1CCC(Nc2ncc(Br)c(OC3CCCCCC3O)n2)CC1 |
| InChI | InChI=1S/C17H27BrN4O4S/c1-27(24,25)22-9-7-12(8-10-22)20-17-19-11-13(18)16(21-17)26-15-6-4-2-3-5-14(15)23/h11-12,14-15,23H,2-10H2,1H3,(H,19,20,21) |
| InChIKey | KNSBENBIJKAOTM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |