C19H25BrN4O8S — CID 154520392
[(3S,3aR,6S,6aR)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 5-bromo-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidine-4-carboxylate (PubChem CID 154520392) has the molecular formula C19H25BrN4O8S and a molecular weight of 549.40 g/mol. Its IUPAC name is [(3S,3aR,6S,6aR)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 5-bromo-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidine-4-carboxylate.
| Compound Name | [(3S,3aR,6S,6aR)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 5-bromo-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 154520392 |
| Molecular Formula | C19H25BrN4O8S |
| Molecular Weight | 549.40 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | [(3S,3aR,6S,6aR)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 5-bromo-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidine-4-carboxylate |
| SMILES | CC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC(=O)c1nc(NC2CCN(S(C)(=O)=O)CC2)ncc1Br |
| InChI | InChI=1S/C19H25BrN4O8S/c1-10(25)31-13-8-29-17-14(9-30-16(13)17)32-18(26)15-12(20)7-21-19(23-15)22-11-3-5-24(6-4-11)33(2,27)28/h7,11,13-14,16-17H,3-6,8-9H2,1-2H3,(H,21,22,23)/t13-,14-,16+,17+/m0/s1 |
| InChIKey | PDKSEZSCRPXDRY-XJNFMUPTSA-N |
| XLogP | 0.33 |
| TPSA | 146.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |